C25H35N3O5 — CID 163164627
4-[4-[(8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl)methyl]piperazin-1-yl]-N-hydroxybenzeneamine oxide (PubChem CID 163164627) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is 4-[4-[(8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl)methyl]piperazin-1-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[4-[(8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl)methyl]piperazin-1-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163164627 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 4-[4-[(8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl)methyl]piperazin-1-yl]-N-hydroxybenzeneamine oxide |
| SMILES | CC12CCCC3(CO3)C1CC1C(C2)OC(=O)C1CN1CCN(c2ccc([NH+]([O-])O)cc2)CC1 |
| InChI | InChI=1S/C25H35N3O5/c1-24-7-2-8-25(16-32-25)22(24)13-19-20(23(29)33-21(19)14-24)15-26-9-11-27(12-10-26)17-3-5-18(6-4-17)28(30)31/h3-6,19-22,28,30H,2,7-16H2,1H3 |
| InChIKey | SGENRWKDJLOUQB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|