C16H28N- — CID 163166138
methyl-[(1S,2R,5S,8R)-4,4,8-trimethyl-2-tricyclo[6.3.1.01,5]dodecanyl]azanide (PubChem CID 163166138) has the molecular formula C16H28N- and a molecular weight of 234.41 g/mol. Its IUPAC name is methyl-[(1S,2R,5S,8R)-4,4,8-trimethyl-2-tricyclo[6.3.1.01,5]dodecanyl]azanide.
| Compound Name | methyl-[(1S,2R,5S,8R)-4,4,8-trimethyl-2-tricyclo[6.3.1.01,5]dodecanyl]azanide |
|---|---|
| PubChem CID | 163166138 |
| Molecular Formula | C16H28N- |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.22 |
| IUPAC Name | methyl-[(1S,2R,5S,8R)-4,4,8-trimethyl-2-tricyclo[6.3.1.01,5]dodecanyl]azanide |
| SMILES | C[N-][C@@H]1CC(C)(C)[C@@H]2CC[C@@]3(C)CCC[C@@]12C3 |
| InChI | InChI=1S/C16H28N/c1-14(2)10-13(17-4)16-8-5-7-15(3,11-16)9-6-12(14)16/h12-13H,5-11H2,1-4H3/q-1/t12-,13+,15+,16-/m0/s1 |
| InChIKey | VULZNGJNVMPHBN-XNISGKROSA-N |
| XLogP | 4.77 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |