C26H48N5+ — CID 163168836
7-[9-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3,7-dimethylnona-2,6-dienyl]-9-methyl-1,2,3,4,5,6,8,9-octahydropurin-9-ium-6-amine (PubChem CID 163168836) has the molecular formula C26H48N5+ and a molecular weight of 430.71 g/mol. Its IUPAC name is 7-[9-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3,7-dimethylnona-2,6-dienyl]-9-methyl-1,2,3,4,5,6,8,9-octahydropurin-9-ium-6-amine.
| Compound Name | 7-[9-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3,7-dimethylnona-2,6-dienyl]-9-methyl-1,2,3,4,5,6,8,9-octahydropurin-9-ium-6-amine |
|---|---|
| PubChem CID | 163168836 |
| Molecular Formula | C26H48N5+ |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.39 |
| IUPAC Name | 7-[9-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3,7-dimethylnona-2,6-dienyl]-9-methyl-1,2,3,4,5,6,8,9-octahydropurin-9-ium-6-amine |
| SMILES | C=C1CCCC(C)(C)[C@H]1CCC(C)=CCCC(C)=CCN1C[NH+](C)C2NCNC(N)C21 |
| InChI | InChI=1S/C26H47N5/c1-19(12-13-22-21(3)11-8-15-26(22,4)5)9-7-10-20(2)14-16-31-18-30(6)25-23(31)24(27)28-17-29-25/h9,14,22-25,28-29H,3,7-8,10-13,15-18,27H2,1-2,4-6H3/p+1/t22-,23?,24?,25?/m0/s1 |
| InChIKey | IJMCLNXWZXPEIS-XKBRHGKYSA-O |
| XLogP | 2.74 |
| TPSA | 57.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|