C36H33N5O12 — CID 163170494
9-[2-[[4-(2-hydroxy-4-oxobutoxy)-9,10-dioxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]phenyl]-2-imino-8,9-dihydropurin-9-ium-6-olate (PubChem CID 163170494) has the molecular formula C36H33N5O12 and a molecular weight of 727.68 g/mol. Its IUPAC name is 9-[2-[[4-(2-hydroxy-4-oxobutoxy)-9,10-dioxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]phenyl]-2-imino-8,9-dihydropurin-9-ium-6-olate.
| Compound Name | 9-[2-[[4-(2-hydroxy-4-oxobutoxy)-9,10-dioxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]phenyl]-2-imino-8,9-dihydropurin-9-ium-6-olate |
|---|---|
| PubChem CID | 163170494 |
| Molecular Formula | C36H33N5O12 |
| Molecular Weight | 727.68 g/mol |
| Exact Mass | 727.21 |
| IUPAC Name | 9-[2-[[4-(2-hydroxy-4-oxobutoxy)-9,10-dioxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-2-yl]methyl]phenyl]-2-imino-8,9-dihydropurin-9-ium-6-olate |
| SMILES | [H]/N=C1\N=C([O-])C2=NC[NH+](c3ccccc3Cc3cc4c(c(OCC(O)CC=O)c3OC3OC(CO)C(O)C(O)C3O)C(=O)c3ccccc3C4=O)C2=N1 |
| InChI | InChI=1S/C36H33N5O12/c37-36-39-33-25(34(50)40-36)38-15-41(33)22-8-4-1-5-16(22)11-17-12-21-24(27(46)20-7-3-2-6-19(20)26(21)45)32(51-14-18(44)9-10-42)31(17)53-35-30(49)29(48)28(47)23(13-43)52-35/h1-8,10,12,18,23,28-30,35,43-44,47-49H,9,11,13-15H2,(H2,37,40,50) |
| InChIKey | VEIVEDHOAJOHSU-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 268.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.68 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|