C16H25N3O10 — CID 163171735
[2-[(2R,3S,4S,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethylamino]azaniumylideneazanide (PubChem CID 163171735) has the molecular formula C16H25N3O10 and a molecular weight of 419.39 g/mol. Its IUPAC name is [2-[(2R,3S,4S,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethylamino]azaniumylideneazanide.
| Compound Name | [2-[(2R,3S,4S,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethylamino]azaniumylideneazanide |
|---|---|
| PubChem CID | 163171735 |
| Molecular Formula | C16H25N3O10 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [2-[(2R,3S,4S,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethylamino]azaniumylideneazanide |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](OCCN[NH+]=[N-])[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H25N3O10/c1-8(20)25-7-12-13(26-9(2)21)14(27-10(3)22)15(28-11(4)23)16(29-12)24-6-5-18-19-17/h12-16,19H,5-7H2,1-4H3,(H-,17,18)/t12-,13-,14-,15-,16+/m0/s1 |
| InChIKey | VQGCXZAIPWNBOL-UVPYHEFZSA-N |
| XLogP | -2.31 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|