C23H43N3O+2 — CID 163172098
[(1S,3R,7S,8R,9S)-1-[(1R,3S)-3-[(6-aminopiperidin-1-ium-3-yl)methyl]cyclohexyl]-3-methyl-2-oxatricyclo[5.3.1.03,8]undecan-9-yl]azanium (PubChem CID 163172098) has the molecular formula C23H43N3O+2 and a molecular weight of 377.62 g/mol. Its IUPAC name is [(1S,3R,7S,8R,9S)-1-[(1R,3S)-3-[(6-aminopiperidin-1-ium-3-yl)methyl]cyclohexyl]-3-methyl-2-oxatricyclo[5.3.1.03,8]undecan-9-yl]azanium.
| Compound Name | [(1S,3R,7S,8R,9S)-1-[(1R,3S)-3-[(6-aminopiperidin-1-ium-3-yl)methyl]cyclohexyl]-3-methyl-2-oxatricyclo[5.3.1.03,8]undecan-9-yl]azanium |
|---|---|
| PubChem CID | 163172098 |
| Molecular Formula | C23H43N3O+2 |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.34 |
| IUPAC Name | [(1S,3R,7S,8R,9S)-1-[(1R,3S)-3-[(6-aminopiperidin-1-ium-3-yl)methyl]cyclohexyl]-3-methyl-2-oxatricyclo[5.3.1.03,8]undecan-9-yl]azanium |
| SMILES | C[C@@]12CCC[C@H]3C[C@@]([C@@H]4CCC[C@@H](CC5CCC(N)[NH2+]C5)C4)(C[C@H]([NH3+])[C@@H]31)O2 |
| InChI | InChI=1S/C23H41N3O/c1-22-9-3-5-17-12-23(27-22,13-19(24)21(17)22)18-6-2-4-15(11-18)10-16-7-8-20(25)26-14-16/h15-21,26H,2-14,24-25H2,1H3/p+2/t15-,16?,17-,18+,19-,20?,21+,22+,23-/m0/s1 |
| InChIKey | AIWFXZKTKYMBBS-LSRKTUTFSA-P |
| XLogP | 1.79 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |