C29H51N3O2 — CID 163151045
2-[(1S,3R,7S,8R,9S)-9-amino-1-[(7S,9S)-7-[(6-aminopiperidin-3-yl)methyl]spiro[4.5]decan-9-yl]-3-methyl-2-oxatricyclo[5.3.1.03,8]undecan-9-yl]ethanol (PubChem CID 163151045) has the molecular formula C29H51N3O2 and a molecular weight of 473.75 g/mol. Its IUPAC name is 2-[(1S,3R,7S,8R,9S)-9-amino-1-[(7S,9S)-7-[(6-aminopiperidin-3-yl)methyl]spiro[4.5]decan-9-yl]-3-methyl-2-oxatricyclo[5.3.1.03,8]undecan-9-yl]ethanol.
| Compound Name | 2-[(1S,3R,7S,8R,9S)-9-amino-1-[(7S,9S)-7-[(6-aminopiperidin-3-yl)methyl]spiro[4.5]decan-9-yl]-3-methyl-2-oxatricyclo[5.3.1.03,8]undecan-9-yl]ethanol |
|---|---|
| PubChem CID | 163151045 |
| Molecular Formula | C29H51N3O2 |
| Molecular Weight | 473.75 g/mol |
| Exact Mass | 473.40 |
| IUPAC Name | 2-[(1S,3R,7S,8R,9S)-9-amino-1-[(7S,9S)-7-[(6-aminopiperidin-3-yl)methyl]spiro[4.5]decan-9-yl]-3-methyl-2-oxatricyclo[5.3.1.03,8]undecan-9-yl]ethanol |
| SMILES | C[C@@]12CCC[C@H]3C[C@@]([C@H]4C[C@H](CC5CCC(N)NC5)CC5(CCCC5)C4)(C[C@@](N)(CCO)[C@@H]31)O2 |
| InChI | InChI=1S/C29H51N3O2/c1-26-8-4-5-22-16-29(34-26,19-28(31,11-12-33)25(22)26)23-14-21(13-20-6-7-24(30)32-18-20)15-27(17-23)9-2-3-10-27/h20-25,32-33H,2-19,30-31H2,1H3/t20?,21-,22-,23-,24?,25-,26+,28-,29-/m0/s1 |
| InChIKey | CRDLFPLMMSFOSB-WSKYFXTHSA-N |
| XLogP | 4.46 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.75 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |