C28H47N3O2 — CID 163180942
2-[(1S,3R,4R,5S)-5-amino-1-[(1S,3S)-3-[(2-amino-1,2-dihydropyridin-5-yl)methyl]cyclohexyl]-3-cyclohexyl-3-methyl-2-oxabicyclo[2.2.2]octan-5-yl]ethanol (PubChem CID 163180942) has the molecular formula C28H47N3O2 and a molecular weight of 457.70 g/mol. Its IUPAC name is 2-[(1S,3R,4R,5S)-5-amino-1-[(1S,3S)-3-[(2-amino-1,2-dihydropyridin-5-yl)methyl]cyclohexyl]-3-cyclohexyl-3-methyl-2-oxabicyclo[2.2.2]octan-5-yl]ethanol.
| Compound Name | 2-[(1S,3R,4R,5S)-5-amino-1-[(1S,3S)-3-[(2-amino-1,2-dihydropyridin-5-yl)methyl]cyclohexyl]-3-cyclohexyl-3-methyl-2-oxabicyclo[2.2.2]octan-5-yl]ethanol |
|---|---|
| PubChem CID | 163180942 |
| Molecular Formula | C28H47N3O2 |
| Molecular Weight | 457.70 g/mol |
| Exact Mass | 457.37 |
| IUPAC Name | 2-[(1S,3R,4R,5S)-5-amino-1-[(1S,3S)-3-[(2-amino-1,2-dihydropyridin-5-yl)methyl]cyclohexyl]-3-cyclohexyl-3-methyl-2-oxabicyclo[2.2.2]octan-5-yl]ethanol |
| SMILES | C[C@]1(C2CCCCC2)O[C@@]2([C@H]3CCC[C@H](CC4=CNC(N)C=C4)C3)CC[C@@H]1[C@](N)(CCO)C2 |
| InChI | InChI=1S/C28H47N3O2/c1-26(22-7-3-2-4-8-22)24-12-13-28(33-26,19-27(24,30)14-15-32)23-9-5-6-20(17-23)16-21-10-11-25(29)31-18-21/h10-11,18,20,22-25,31-32H,2-9,12-17,19,29-30H2,1H3/t20-,23+,24+,25?,26-,27+,28+/m1/s1 |
| InChIKey | ZBVMDWWIRHPEQH-ODJMBDSRSA-N |
| XLogP | 4.50 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.70 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |