C27H37NO3 — CID 162831532
18-amino-18-(2-hydroxyethyl)-20,20-dimethyl-21-oxapentacyclo[17.2.2.12,6.01,17.08,13]tetracosa-8(13),9,11-trien-15-yn-11-ol (PubChem CID 162831532) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is 18-amino-18-(2-hydroxyethyl)-20,20-dimethyl-21-oxapentacyclo[17.2.2.12,6.01,17.08,13]tetracosa-8(13),9,11-trien-15-yn-11-ol.
| Compound Name | 18-amino-18-(2-hydroxyethyl)-20,20-dimethyl-21-oxapentacyclo[17.2.2.12,6.01,17.08,13]tetracosa-8(13),9,11-trien-15-yn-11-ol |
|---|---|
| PubChem CID | 162831532 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | 18-amino-18-(2-hydroxyethyl)-20,20-dimethyl-21-oxapentacyclo[17.2.2.12,6.01,17.08,13]tetracosa-8(13),9,11-trien-15-yn-11-ol |
| SMILES | CC1(C)OC23CCC1C(N)(CCO)C2C#CCc1cc(O)ccc1CC1CCCC3C1 |
| InChI | InChI=1S/C27H37NO3/c1-25(2)23-11-12-27(31-25)21-7-3-5-18(16-21)15-20-9-10-22(30)17-19(20)6-4-8-24(27)26(23,28)13-14-29/h9-10,17-18,21,23-24,29-30H,3,5-7,11-16,28H2,1-2H3 |
| InChIKey | CQNJCYWDUORDNM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|