C11H14O2 — CID 105437547
2-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol (PubChem CID 105437547) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 2-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 105437547 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol |
| SMILES | OCCC1Cc2ccc(O)cc2C1 |
| InChI | InChI=1S/C11H14O2/c12-4-3-8-5-9-1-2-11(13)7-10(9)6-8/h1-2,7-8,12-13H,3-6H2 |
| InChIKey | KVSQWGQXOSREMU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |