C31H44N2O3 — CID 163097103
(1S,3R,6S,7R,11S,22S,23R,26S)-26-amino-26-(2-hydroxyethyl)-25,25-dimethyl-14-(methylaminomethyl)-24-oxahexacyclo[20.3.1.03,23.06,11.07,23.013,18]hexacosa-13(18),14,16-trien-20-yn-16-ol (PubChem CID 163097103) has the molecular formula C31H44N2O3 and a molecular weight of 492.70 g/mol. Its IUPAC name is (1S,3R,6S,7R,11S,22S,23R,26S)-26-amino-26-(2-hydroxyethyl)-25,25-dimethyl-14-(methylaminomethyl)-24-oxahexacyclo[20.3.1.03,23.06,11.07,23.013,18]hexacosa-13(18),14,16-trien-20-yn-16-ol.
| Compound Name | (1S,3R,6S,7R,11S,22S,23R,26S)-26-amino-26-(2-hydroxyethyl)-25,25-dimethyl-14-(methylaminomethyl)-24-oxahexacyclo[20.3.1.03,23.06,11.07,23.013,18]hexacosa-13(18),14,16-trien-20-yn-16-ol |
|---|---|
| PubChem CID | 163097103 |
| Molecular Formula | C31H44N2O3 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.34 |
| IUPAC Name | (1S,3R,6S,7R,11S,22S,23R,26S)-26-amino-26-(2-hydroxyethyl)-25,25-dimethyl-14-(methylaminomethyl)-24-oxahexacyclo[20.3.1.03,23.06,11.07,23.013,18]hexacosa-13(18),14,16-trien-20-yn-16-ol |
| SMILES | CNCc1cc(O)cc2c1C[C@@H]1CCC[C@@H]3[C@H]1CC[C@@H]1C[C@@H]4C(C)(C)O[C@]13[C@@H](C#CC2)[C@]4(N)CCO |
| InChI | InChI=1S/C31H44N2O3/c1-29(2)28-17-22-10-11-24-20-6-4-8-26(24)31(22,36-29)27(30(28,32)12-13-34)9-5-7-19-14-23(35)15-21(18-33-3)25(19)16-20/h14-15,20,22,24,26-28,33-35H,4,6-8,10-13,16-18,32H2,1-3H3/t20-,22+,24-,26+,27-,28+,30+,31+/m0/s1 |
| InChIKey | DYQAIYVWYYKVPZ-NTLOVEAVSA-N |
| XLogP | 3.92 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|