C42H61NO3 — CID 163100535
18-amino-24-cyclohexyl-19-(hydroxymethyl)-24-methyl-3'-(2-methylpropyl)spiro[25-oxahexacyclo[20.3.1.12,6.01,17.08,13.018,23]heptacosa-8(13),9,11-trien-15-yne-4,1'-cyclopentane]-11-ol (PubChem CID 163100535) has the molecular formula C42H61NO3 and a molecular weight of 627.95 g/mol. Its IUPAC name is 18-amino-24-cyclohexyl-19-(hydroxymethyl)-24-methyl-3'-(2-methylpropyl)spiro[25-oxahexacyclo[20.3.1.12,6.01,17.08,13.018,23]heptacosa-8(13),9,11-trien-15-yne-4,1'-cyclopentane]-11-ol.
| Compound Name | 18-amino-24-cyclohexyl-19-(hydroxymethyl)-24-methyl-3'-(2-methylpropyl)spiro[25-oxahexacyclo[20.3.1.12,6.01,17.08,13.018,23]heptacosa-8(13),9,11-trien-15-yne-4,1'-cyclopentane]-11-ol |
|---|---|
| PubChem CID | 163100535 |
| Molecular Formula | C42H61NO3 |
| Molecular Weight | 627.95 g/mol |
| Exact Mass | 627.47 |
| IUPAC Name | 18-amino-24-cyclohexyl-19-(hydroxymethyl)-24-methyl-3'-(2-methylpropyl)spiro[25-oxahexacyclo[20.3.1.12,6.01,17.08,13.018,23]heptacosa-8(13),9,11-trien-15-yne-4,1'-cyclopentane]-11-ol |
| SMILES | CC(C)CC1CCC2(C1)CC1Cc3ccc(O)cc3CC#CC3C4(CC5CCC(CO)C3(N)C5C(C)(C3CCCCC3)O4)C(C1)C2 |
| InChI | InChI=1S/C42H61NO3/c1-27(2)18-28-16-17-40(22-28)23-29-19-31-13-15-36(45)21-30(31)8-7-11-37-41(35(20-29)25-40)24-32-12-14-34(26-44)42(37,43)38(32)39(3,46-41)33-9-5-4-6-10-33/h13,15,21,27-29,32-35,37-38,44-45H,4-6,8-10,12,14,16-20,22-26,43H2,1-3H3 |
| InChIKey | KVZUHSISJYFFPZ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.95 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|