C33H48N2O3 — CID 163098343
18-amino-19-(hydroxymethyl)-24,24-dimethyl-9-(propylaminomethyl)-25-oxahexacyclo[20.3.1.12,6.01,17.08,13.018,23]heptacosa-8(13),9,11-trien-15-yn-11-ol (PubChem CID 163098343) has the molecular formula C33H48N2O3 and a molecular weight of 520.76 g/mol. Its IUPAC name is 18-amino-19-(hydroxymethyl)-24,24-dimethyl-9-(propylaminomethyl)-25-oxahexacyclo[20.3.1.12,6.01,17.08,13.018,23]heptacosa-8(13),9,11-trien-15-yn-11-ol.
| Compound Name | 18-amino-19-(hydroxymethyl)-24,24-dimethyl-9-(propylaminomethyl)-25-oxahexacyclo[20.3.1.12,6.01,17.08,13.018,23]heptacosa-8(13),9,11-trien-15-yn-11-ol |
|---|---|
| PubChem CID | 163098343 |
| Molecular Formula | C33H48N2O3 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.37 |
| IUPAC Name | 18-amino-19-(hydroxymethyl)-24,24-dimethyl-9-(propylaminomethyl)-25-oxahexacyclo[20.3.1.12,6.01,17.08,13.018,23]heptacosa-8(13),9,11-trien-15-yn-11-ol |
| SMILES | CCCNCc1cc(O)cc2c1CC1CCCC(C1)C13CC4CCC(CO)C(N)(C4C(C)(C)O1)C3C#CC2 |
| InChI | InChI=1S/C33H48N2O3/c1-4-13-35-19-24-17-27(37)16-22-8-6-10-29-32(25-9-5-7-21(14-25)15-28(22)24)18-23-11-12-26(20-36)33(29,34)30(23)31(2,3)38-32/h16-17,21,23,25-26,29-30,35-37H,4-5,7-9,11-15,18-20,34H2,1-3H3 |
| InChIKey | ZOIWPCLAHBSEHW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|