C29H47N3O2 — CID 163169223
[(1S,3R,4S,7S,8R)-3-amino-1-[(7R,9S)-7-[(2-amino-1,2-dihydropyridin-5-yl)methyl]spiro[4.5]decan-9-yl]-9,9-dimethyl-10-oxatricyclo[5.3.1.03,8]undecan-4-yl]methanol (PubChem CID 163169223) has the molecular formula C29H47N3O2 and a molecular weight of 469.71 g/mol. Its IUPAC name is [(1S,3R,4S,7S,8R)-3-amino-1-[(7R,9S)-7-[(2-amino-1,2-dihydropyridin-5-yl)methyl]spiro[4.5]decan-9-yl]-9,9-dimethyl-10-oxatricyclo[5.3.1.03,8]undecan-4-yl]methanol.
| Compound Name | [(1S,3R,4S,7S,8R)-3-amino-1-[(7R,9S)-7-[(2-amino-1,2-dihydropyridin-5-yl)methyl]spiro[4.5]decan-9-yl]-9,9-dimethyl-10-oxatricyclo[5.3.1.03,8]undecan-4-yl]methanol |
|---|---|
| PubChem CID | 163169223 |
| Molecular Formula | C29H47N3O2 |
| Molecular Weight | 469.71 g/mol |
| Exact Mass | 469.37 |
| IUPAC Name | [(1S,3R,4S,7S,8R)-3-amino-1-[(7R,9S)-7-[(2-amino-1,2-dihydropyridin-5-yl)methyl]spiro[4.5]decan-9-yl]-9,9-dimethyl-10-oxatricyclo[5.3.1.03,8]undecan-4-yl]methanol |
| SMILES | CC1(C)O[C@@]2([C@H]3C[C@@H](CC4=CNC(N)C=C4)CC4(CCCC4)C3)C[C@@H]3CC[C@H](CO)[C@](N)(C2)[C@@H]31 |
| InChI | InChI=1S/C29H47N3O2/c1-26(2)25-21-6-7-22(17-33)29(25,31)18-28(14-21,34-26)23-12-20(11-19-5-8-24(30)32-16-19)13-27(15-23)9-3-4-10-27/h5,8,16,20-25,32-33H,3-4,6-7,9-15,17-18,30-31H2,1-2H3/t20-,21+,22-,23+,24?,25+,28+,29-/m1/s1 |
| InChIKey | URFUEAASHGCKEN-SZSKPXKCSA-N |
| XLogP | 4.35 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.71 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |