C30H48O — CID 163172328
(1R,2R,5R,10R,11R,14R,15R,16S,17R,20R)-2,6,6,10,16,17,20-heptamethylhexacyclo[12.8.1.01,14.02,11.05,10.015,20]tricosan-7-one (PubChem CID 163172328) has the molecular formula C30H48O and a molecular weight of 424.71 g/mol. Its IUPAC name is (1R,2R,5R,10R,11R,14R,15R,16S,17R,20R)-2,6,6,10,16,17,20-heptamethylhexacyclo[12.8.1.01,14.02,11.05,10.015,20]tricosan-7-one.
| Compound Name | (1R,2R,5R,10R,11R,14R,15R,16S,17R,20R)-2,6,6,10,16,17,20-heptamethylhexacyclo[12.8.1.01,14.02,11.05,10.015,20]tricosan-7-one |
|---|---|
| PubChem CID | 163172328 |
| Molecular Formula | C30H48O |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.37 |
| IUPAC Name | (1R,2R,5R,10R,11R,14R,15R,16S,17R,20R)-2,6,6,10,16,17,20-heptamethylhexacyclo[12.8.1.01,14.02,11.05,10.015,20]tricosan-7-one |
| SMILES | C[C@H]1[C@H](C)CC[C@]2(C)CC[C@]34C[C@]3(CC[C@@H]3[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]34C)[C@H]12 |
| InChI | InChI=1S/C30H48O/c1-19-8-12-26(5)16-17-30-18-29(30,24(26)20(19)2)15-10-22-27(6)13-11-23(31)25(3,4)21(27)9-14-28(22,30)7/h19-22,24H,8-18H2,1-7H3/t19-,20+,21+,22-,24-,26-,27+,28-,29-,30-/m1/s1 |
| InChIKey | VVSOUTKITCBWGW-SPBYGQQGSA-N |
| XLogP | 8.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |