C21H17NO6 — CID 163173539
N-hydroxy-4-[[2-[(5-methylfuran-2-yl)methylidene]-3-oxo-1-benzofuran-6-yl]oxymethyl]benzeneamine oxide (PubChem CID 163173539) has the molecular formula C21H17NO6 and a molecular weight of 379.37 g/mol. Its IUPAC name is N-hydroxy-4-[[2-[(5-methylfuran-2-yl)methylidene]-3-oxo-1-benzofuran-6-yl]oxymethyl]benzeneamine oxide.
| Compound Name | N-hydroxy-4-[[2-[(5-methylfuran-2-yl)methylidene]-3-oxo-1-benzofuran-6-yl]oxymethyl]benzeneamine oxide |
|---|---|
| PubChem CID | 163173539 |
| Molecular Formula | C21H17NO6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-hydroxy-4-[[2-[(5-methylfuran-2-yl)methylidene]-3-oxo-1-benzofuran-6-yl]oxymethyl]benzeneamine oxide |
| SMILES | Cc1ccc(C=C2Oc3cc(OCc4ccc([NH+]([O-])O)cc4)ccc3C2=O)o1 |
| InChI | InChI=1S/C21H17NO6/c1-13-2-7-17(27-13)11-20-21(23)18-9-8-16(10-19(18)28-20)26-12-14-3-5-15(6-4-14)22(24)25/h2-11,22,24H,12H2,1H3 |
| InChIKey | WIPQBCXNYBLQNE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 96.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|