C26H31N2O9+ — CID 163174985
17-ethenyl-18-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-19-oxa-12-aza-2-azoniapentacyclo[14.3.1.02,14.05,13.06,11]icosa-3,5(13),6,8,10-pentaene-20-carboxylic acid (PubChem CID 163174985) has the molecular formula C26H31N2O9+ and a molecular weight of 515.54 g/mol. Its IUPAC name is 17-ethenyl-18-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-19-oxa-12-aza-2-azoniapentacyclo[14.3.1.02,14.05,13.06,11]icosa-3,5(13),6,8,10-pentaene-20-carboxylic acid.
| Compound Name | 17-ethenyl-18-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-19-oxa-12-aza-2-azoniapentacyclo[14.3.1.02,14.05,13.06,11]icosa-3,5(13),6,8,10-pentaene-20-carboxylic acid |
|---|---|
| PubChem CID | 163174985 |
| Molecular Formula | C26H31N2O9+ |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 17-ethenyl-18-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-19-oxa-12-aza-2-azoniapentacyclo[14.3.1.02,14.05,13.06,11]icosa-3,5(13),6,8,10-pentaene-20-carboxylic acid |
| SMILES | C=CC1C(OC2OC(CO)C(O)C(O)C2O)OC2C(C(=O)O)C1CC1c3[nH]c4ccccc4c3C=C[NH+]12 |
| InChI | InChI=1S/C26H30N2O9/c1-2-11-14-9-16-19-13(12-5-3-4-6-15(12)27-19)7-8-28(16)23(18(14)24(33)34)36-25(11)37-26-22(32)21(31)20(30)17(10-29)35-26/h2-8,11,14,16-18,20-23,25-27,29-32H,1,9-10H2,(H,33,34)/p+1 |
| InChIKey | TUTJYRRTIOKXJN-UHFFFAOYSA-O |
| XLogP | -0.90 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|