C17H16N5O3S- — CID 163177313
N-[4-[(6R)-3-(4-ethoxyphenyl)-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl]-N-oxidohydroxylamine (PubChem CID 163177313) has the molecular formula C17H16N5O3S- and a molecular weight of 370.41 g/mol. Its IUPAC name is N-[4-[(6R)-3-(4-ethoxyphenyl)-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl]-N-oxidohydroxylamine.
| Compound Name | N-[4-[(6R)-3-(4-ethoxyphenyl)-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 163177313 |
| Molecular Formula | C17H16N5O3S- |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | N-[4-[(6R)-3-(4-ethoxyphenyl)-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl]-N-oxidohydroxylamine |
| SMILES | CCOc1ccc(-c2nnc3n2N[C@@H](c2ccc(N([O-])O)cc2)S3)cc1 |
| InChI | InChI=1S/C17H16N5O3S/c1-2-25-14-9-5-11(6-10-14)15-18-19-17-21(15)20-16(26-17)12-3-7-13(8-4-12)22(23)24/h3-10,16,20,23H,2H2,1H3/q-1/t16-/m1/s1 |
| InChIKey | QVYQMIFJECABPW-MRXNPFEDSA-N |
| XLogP | 3.39 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|