C16H28N- — CID 163178009
[(3S,4R,5R,10S)-3,10-dimethyl-7-propan-2-ylspiro[4.5]dec-6-en-4-yl]-methylazanide (PubChem CID 163178009) has the molecular formula C16H28N- and a molecular weight of 234.41 g/mol. Its IUPAC name is [(3S,4R,5R,10S)-3,10-dimethyl-7-propan-2-ylspiro[4.5]dec-6-en-4-yl]-methylazanide.
| Compound Name | [(3S,4R,5R,10S)-3,10-dimethyl-7-propan-2-ylspiro[4.5]dec-6-en-4-yl]-methylazanide |
|---|---|
| PubChem CID | 163178009 |
| Molecular Formula | C16H28N- |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.22 |
| IUPAC Name | [(3S,4R,5R,10S)-3,10-dimethyl-7-propan-2-ylspiro[4.5]dec-6-en-4-yl]-methylazanide |
| SMILES | C[N-][C@@H]1[C@@H](C)CC[C@@]12C=C(C(C)C)CC[C@@H]2C |
| InChI | InChI=1S/C16H28N/c1-11(2)14-7-6-13(4)16(10-14)9-8-12(3)15(16)17-5/h10-13,15H,6-9H2,1-5H3/q-1/t12-,13-,15+,16-/m0/s1 |
| InChIKey | QZNCNAHFHQEWEX-UGQVUOCMSA-N |
| XLogP | 4.79 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|