C20H25N2O5- — CID 163179663
2-(6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-1-[3-[hydroxy(oxido)amino]phenyl]ethanol (PubChem CID 163179663) has the molecular formula C20H25N2O5- and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-1-[3-[hydroxy(oxido)amino]phenyl]ethanol.
| Compound Name | 2-(6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-1-[3-[hydroxy(oxido)amino]phenyl]ethanol |
|---|---|
| PubChem CID | 163179663 |
| Molecular Formula | C20H25N2O5- |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-(6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-1-[3-[hydroxy(oxido)amino]phenyl]ethanol |
| SMILES | COc1cc2c(cc1OC)C(C)N(CC(O)c1cccc(N([O-])O)c1)CC2 |
| InChI | InChI=1S/C20H25N2O5/c1-13-17-11-20(27-3)19(26-2)10-14(17)7-8-21(13)12-18(23)15-5-4-6-16(9-15)22(24)25/h4-6,9-11,13,18,23-24H,7-8,12H2,1-3H3/q-1 |
| InChIKey | LVWADYACNJYWKA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|