C14H16N4O5S — CID 163180238
4-(5-amino-4-ethoxycarbonyl-3-methylsulfanylpyrazole-1-carbonyl)-N-hydroxybenzeneamine oxide (PubChem CID 163180238) has the molecular formula C14H16N4O5S and a molecular weight of 352.37 g/mol. Its IUPAC name is 4-(5-amino-4-ethoxycarbonyl-3-methylsulfanylpyrazole-1-carbonyl)-N-hydroxybenzeneamine oxide.
| Compound Name | 4-(5-amino-4-ethoxycarbonyl-3-methylsulfanylpyrazole-1-carbonyl)-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163180238 |
| Molecular Formula | C14H16N4O5S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 4-(5-amino-4-ethoxycarbonyl-3-methylsulfanylpyrazole-1-carbonyl)-N-hydroxybenzeneamine oxide |
| SMILES | CCOC(=O)c1c(SC)nn(C(=O)c2ccc([NH+]([O-])O)cc2)c1N |
| InChI | InChI=1S/C14H16N4O5S/c1-3-23-14(20)10-11(15)17(16-12(10)24-2)13(19)8-4-6-9(7-5-8)18(21)22/h4-7,18,21H,3,15H2,1-2H3 |
| InChIKey | YVDMBSPOAULDTP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|