C14H16N4O2S2 — CID 3350129
ethyl 5-amino-3-methylsulfanyl-1-(phenylcarbamothioyl)pyrazole-4-carboxylate (PubChem CID 3350129) has the molecular formula C14H16N4O2S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is ethyl 5-amino-3-methylsulfanyl-1-(phenylcarbamothioyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-amino-3-methylsulfanyl-1-(phenylcarbamothioyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 3350129 |
| Molecular Formula | C14H16N4O2S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | ethyl 5-amino-3-methylsulfanyl-1-(phenylcarbamothioyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(SC)nn(C(=S)Nc2ccccc2)c1N |
| InChI | InChI=1S/C14H16N4O2S2/c1-3-20-13(19)10-11(15)18(17-12(10)22-2)14(21)16-9-7-5-4-6-8-9/h4-8H,3,15H2,1-2H3,(H,16,21) |
| InChIKey | NUWNKFMSSSCLRQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|