C21H18N4O7-2 — CID 163181803
(2S)-N-[[3-[2-(dihydroxyamino)-4-(dioxidoamino)phenoxy]phenyl]methylideneamino]-2-hydroxy-2-phenylacetamide (PubChem CID 163181803) has the molecular formula C21H18N4O7-2 and a molecular weight of 438.40 g/mol. Its IUPAC name is (2S)-N-[[3-[2-(dihydroxyamino)-4-(dioxidoamino)phenoxy]phenyl]methylideneamino]-2-hydroxy-2-phenylacetamide.
| Compound Name | (2S)-N-[[3-[2-(dihydroxyamino)-4-(dioxidoamino)phenoxy]phenyl]methylideneamino]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 163181803 |
| Molecular Formula | C21H18N4O7-2 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (2S)-N-[[3-[2-(dihydroxyamino)-4-(dioxidoamino)phenoxy]phenyl]methylideneamino]-2-hydroxy-2-phenylacetamide |
| SMILES | O=C(NN=Cc1cccc(Oc2ccc(N([O-])[O-])cc2N(O)O)c1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C21H18N4O7/c26-20(15-6-2-1-3-7-15)21(27)23-22-13-14-5-4-8-17(11-14)32-19-10-9-16(24(28)29)12-18(19)25(30)31/h1-13,20,26,30-31H,(H,23,27)/q-2/t20-/m0/s1 |
| InChIKey | FZQOTHCDILHBAF-FQEVSTJZSA-N |
| XLogP | 3.05 |
| TPSA | 163.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|