C30H40O8 — CID 163182319
6-(8,15-dihydroxy-4,4,10,13,14-pentamethyl-3,7,12-trioxo-2,5,6,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxohept-5-enoic acid (PubChem CID 163182319) has the molecular formula C30H40O8 and a molecular weight of 528.64 g/mol. Its IUPAC name is 6-(8,15-dihydroxy-4,4,10,13,14-pentamethyl-3,7,12-trioxo-2,5,6,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxohept-5-enoic acid.
| Compound Name | 6-(8,15-dihydroxy-4,4,10,13,14-pentamethyl-3,7,12-trioxo-2,5,6,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxohept-5-enoic acid |
|---|---|
| PubChem CID | 163182319 |
| Molecular Formula | C30H40O8 |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 6-(8,15-dihydroxy-4,4,10,13,14-pentamethyl-3,7,12-trioxo-2,5,6,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxohept-5-enoic acid |
| SMILES | CC(=CC(=O)CC(C)C(=O)O)C1CC(O)C2(C)C3(O)C(=O)CC4C(C)(C)C(=O)CCC4(C)C3=CC(=O)C12C |
| InChI | InChI=1S/C30H40O8/c1-15(10-17(31)11-16(2)25(36)37)18-12-23(34)29(7)28(18,6)22(33)14-20-27(5)9-8-21(32)26(3,4)19(27)13-24(35)30(20,29)38/h10,14,16,18-19,23,34,38H,8-9,11-13H2,1-7H3,(H,36,37) |
| InChIKey | ZPBDWFAEEABCPK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|