C31H58NO2P2+ — CID 163182594
2,6-bis(dicyclohexylphosphorylmethyl)piperidin-1-ium (PubChem CID 163182594) has the molecular formula C31H58NO2P2+ and a molecular weight of 538.76 g/mol. Its IUPAC name is 2,6-bis(dicyclohexylphosphorylmethyl)piperidin-1-ium.
| Compound Name | 2,6-bis(dicyclohexylphosphorylmethyl)piperidin-1-ium |
|---|---|
| PubChem CID | 163182594 |
| Molecular Formula | C31H58NO2P2+ |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.39 |
| IUPAC Name | 2,6-bis(dicyclohexylphosphorylmethyl)piperidin-1-ium |
| SMILES | O=P(CC1CCCC(CP(=O)(C2CCCCC2)C2CCCCC2)[NH2+]1)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C31H57NO2P2/c33-35(28-16-5-1-6-17-28,29-18-7-2-8-19-29)24-26-14-13-15-27(32-26)25-36(34,30-20-9-3-10-21-30)31-22-11-4-12-23-31/h26-32H,1-25H2/p+1 |
| InChIKey | GJGZXXVJFNSYIC-UHFFFAOYSA-O |
| XLogP | 8.53 |
| TPSA | 50.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|