C19H28NaO4PS — CID 129318076
sodium 4-(dicyclohexylphosphorylmethyl)benzenesulfonate (PubChem CID 129318076) has the molecular formula C19H28NaO4PS and a molecular weight of 406.46 g/mol. Its IUPAC name is sodium 4-(dicyclohexylphosphorylmethyl)benzenesulfonate.
| Compound Name | sodium 4-(dicyclohexylphosphorylmethyl)benzenesulfonate |
|---|---|
| PubChem CID | 129318076 |
| Molecular Formula | C19H28NaO4PS |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | sodium 4-(dicyclohexylphosphorylmethyl)benzenesulfonate |
| SMILES | O=P(Cc1ccc(S(=O)(=O)[O-])cc1)(C1CCCCC1)C1CCCCC1.[Na+] |
| InChI | InChI=1S/C19H29O4PS.Na/c20-24(17-7-3-1-4-8-17,18-9-5-2-6-10-18)15-16-11-13-19(14-12-16)25(21,22)23;/h11-14,17-18H,1-10,15H2,(H,21,22,23);/q;+1/p-1 |
| InChIKey | OSYMIHUHCNWQLD-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|