C39H32O4S — CID 163184656
(2Z)-2-[[2,3-dimethoxy-9-(2-methylphenyl)-10H-anthracen-9-yl]-(4-methoxyphenyl)methylidene]-1-benzothiophen-3-one (PubChem CID 163184656) has the molecular formula C39H32O4S and a molecular weight of 596.75 g/mol. Its IUPAC name is (2Z)-2-[[2,3-dimethoxy-9-(2-methylphenyl)-10H-anthracen-9-yl]-(4-methoxyphenyl)methylidene]-1-benzothiophen-3-one.
| Compound Name | (2Z)-2-[[2,3-dimethoxy-9-(2-methylphenyl)-10H-anthracen-9-yl]-(4-methoxyphenyl)methylidene]-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 163184656 |
| Molecular Formula | C39H32O4S |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | (2Z)-2-[[2,3-dimethoxy-9-(2-methylphenyl)-10H-anthracen-9-yl]-(4-methoxyphenyl)methylidene]-1-benzothiophen-3-one |
| SMILES | COc1ccc(/C(=C2/Sc3ccccc3C2=O)C2(c3ccccc3C)c3ccccc3Cc3cc(OC)c(OC)cc32)cc1 |
| InChI | InChI=1S/C39H32O4S/c1-24-11-5-8-14-30(24)39(31-15-9-6-12-26(31)21-27-22-33(42-3)34(43-4)23-32(27)39)36(25-17-19-28(41-2)20-18-25)38-37(40)29-13-7-10-16-35(29)44-38/h5-20,22-23H,21H2,1-4H3/b38-36- |
| InChIKey | OABGJGQHMLFTTR-WASYMBJWSA-N |
| XLogP | 8.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|