C19H24O4 — CID 163185137
[(3S,8S,9E)-8-acetyloxypentadeca-1,9-dien-4,6-diyn-3-yl] acetate (PubChem CID 163185137) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is [(3S,8S,9E)-8-acetyloxypentadeca-1,9-dien-4,6-diyn-3-yl] acetate.
| Compound Name | [(3S,8S,9E)-8-acetyloxypentadeca-1,9-dien-4,6-diyn-3-yl] acetate |
|---|---|
| PubChem CID | 163185137 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [(3S,8S,9E)-8-acetyloxypentadeca-1,9-dien-4,6-diyn-3-yl] acetate |
| SMILES | C=C[C@@H](C#CC#C[C@H](/C=C/CCCCC)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C19H24O4/c1-5-7-8-9-10-14-19(23-17(4)21)15-12-11-13-18(6-2)22-16(3)20/h6,10,14,18-19H,2,5,7-9H2,1,3-4H3/b14-10+/t18-,19-/m0/s1 |
| InChIKey | GUUWFDGOIFMLPQ-DTVHYBFXSA-N |
| XLogP | 3.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|