C24H34O4 — CID 71745532
[(3R,4E,16E,18R)-18-acetyloxyicosa-4,16-dien-1,19-diyn-3-yl] acetate (PubChem CID 71745532) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is [(3R,4E,16E,18R)-18-acetyloxyicosa-4,16-dien-1,19-diyn-3-yl] acetate.
| Compound Name | [(3R,4E,16E,18R)-18-acetyloxyicosa-4,16-dien-1,19-diyn-3-yl] acetate |
|---|---|
| PubChem CID | 71745532 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | [(3R,4E,16E,18R)-18-acetyloxyicosa-4,16-dien-1,19-diyn-3-yl] acetate |
| SMILES | C#C[C@@H](/C=C/CCCCCCCCCC/C=C/[C@H](C#C)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C24H34O4/c1-5-23(27-21(3)25)19-17-15-13-11-9-7-8-10-12-14-16-18-20-24(6-2)28-22(4)26/h1-2,17-20,23-24H,7-16H2,3-4H3/b19-17+,20-18+/t23-,24-/m0/s1 |
| InChIKey | VEKIJJQSZPGNBV-NXQTXSFHSA-N |
| XLogP | 5.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|