C22H28N2O4 — CID 163185591
methyl (1S,15S,16S,17S,20R)-17-hydroxy-6-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-3(11),4(9),5,7-tetraene-16-carboxylate (PubChem CID 163185591) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is methyl (1S,15S,16S,17S,20R)-17-hydroxy-6-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-3(11),4(9),5,7-tetraene-16-carboxylate.
| Compound Name | methyl (1S,15S,16S,17S,20R)-17-hydroxy-6-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-3(11),4(9),5,7-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 163185591 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | methyl (1S,15S,16S,17S,20R)-17-hydroxy-6-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-3(11),4(9),5,7-tetraene-16-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2CN3Cc4[nH]c5ccc(OC)cc5c4C[C@@H]3C[C@H]2CC[C@@H]1O |
| InChI | InChI=1S/C22H28N2O4/c1-27-14-4-5-18-16(9-14)15-8-13-7-12-3-6-20(25)21(22(26)28-2)17(12)10-24(13)11-19(15)23-18/h4-5,9,12-13,17,20-21,23,25H,3,6-8,10-11H2,1-2H3/t12-,13+,17+,20+,21+/m1/s1 |
| InChIKey | IJSBYCUQBXKLMJ-IURFZMJQSA-N |
| XLogP | 2.48 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|