C22H34O7 — CID 163185693
[(2R,3S,4R,5S)-4,5-dihydroxy-2-[(3S,6E)-3,7,11-trimethyl-9-oxododeca-1,6,10-trien-3-yl]oxyoxan-3-yl] acetate (PubChem CID 163185693) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-4,5-dihydroxy-2-[(3S,6E)-3,7,11-trimethyl-9-oxododeca-1,6,10-trien-3-yl]oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5S)-4,5-dihydroxy-2-[(3S,6E)-3,7,11-trimethyl-9-oxododeca-1,6,10-trien-3-yl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 163185693 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | [(2R,3S,4R,5S)-4,5-dihydroxy-2-[(3S,6E)-3,7,11-trimethyl-9-oxododeca-1,6,10-trien-3-yl]oxyoxan-3-yl] acetate |
| SMILES | C=C[C@](C)(CC/C=C(\C)CC(=O)C=C(C)C)O[C@H]1OC[C@H](O)[C@@H](O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H34O7/c1-7-22(6,10-8-9-15(4)12-17(24)11-14(2)3)29-21-20(28-16(5)23)19(26)18(25)13-27-21/h7,9,11,18-21,25-26H,1,8,10,12-13H2,2-6H3/b15-9+/t18-,19+,20-,21+,22+/m0/s1 |
| InChIKey | QDTLKMXDFKLFMH-LPUQRJMRSA-N |
| XLogP | 2.61 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|