C27H42O4 — CID 163186031
17-[(2R)-5-hydroperoxy-6-methylhept-6-en-2-yl]-6-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 163186031) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is 17-[(2R)-5-hydroperoxy-6-methylhept-6-en-2-yl]-6-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-[(2R)-5-hydroperoxy-6-methylhept-6-en-2-yl]-6-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 163186031 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | 17-[(2R)-5-hydroperoxy-6-methylhept-6-en-2-yl]-6-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C(C)C(CC[C@@H](C)C1CCC2C3CC(O)C4=CC(=O)CCC4(C)C3CCC21C)OO |
| InChI | InChI=1S/C27H42O4/c1-16(2)25(31-30)9-6-17(3)20-7-8-21-19-15-24(29)23-14-18(28)10-12-27(23,5)22(19)11-13-26(20,21)4/h14,17,19-22,24-25,29-30H,1,6-13,15H2,2-5H3/t17-,19?,20?,21?,22?,24?,25?,26?,27?/m1/s1 |
| InChIKey | ZCYAJVHKULICIB-RPWKCJOISA-N |
| XLogP | 5.96 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|