C27H34O2 — CID 163186808
(1R,4S,7E,9S,10S,12R,16S)-7-benzylidene-16-hydroxy-5,5,9,16-tetramethyltetracyclo[10.2.2.01,10.04,9]hexadec-13-en-6-one (PubChem CID 163186808) has the molecular formula C27H34O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is (1R,4S,7E,9S,10S,12R,16S)-7-benzylidene-16-hydroxy-5,5,9,16-tetramethyltetracyclo[10.2.2.01,10.04,9]hexadec-13-en-6-one.
| Compound Name | (1R,4S,7E,9S,10S,12R,16S)-7-benzylidene-16-hydroxy-5,5,9,16-tetramethyltetracyclo[10.2.2.01,10.04,9]hexadec-13-en-6-one |
|---|---|
| PubChem CID | 163186808 |
| Molecular Formula | C27H34O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (1R,4S,7E,9S,10S,12R,16S)-7-benzylidene-16-hydroxy-5,5,9,16-tetramethyltetracyclo[10.2.2.01,10.04,9]hexadec-13-en-6-one |
| SMILES | CC1(C)C(=O)/C(=C/c2ccccc2)C[C@]2(C)[C@@H]1CC[C@@]13C=C[C@@H](C[C@H]12)[C@@](C)(O)C3 |
| InChI | InChI=1S/C27H34O2/c1-24(2)21-11-13-27-12-10-20(26(4,29)17-27)15-22(27)25(21,3)16-19(23(24)28)14-18-8-6-5-7-9-18/h5-10,12,14,20-22,29H,11,13,15-17H2,1-4H3/b19-14+/t20-,21+,22-,25+,26-,27+/m0/s1 |
| InChIKey | KFTJQBMBWGAXNI-HCLFTBTMSA-N |
| XLogP | 5.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|