C16H22O — CID 163188348
(3aR,5aR,9aS,9bS)-5a-methyl-3,9-dimethylidene-3a,4,5,6,7,8,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-2-one (PubChem CID 163188348) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (3aR,5aR,9aS,9bS)-5a-methyl-3,9-dimethylidene-3a,4,5,6,7,8,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-2-one.
| Compound Name | (3aR,5aR,9aS,9bS)-5a-methyl-3,9-dimethylidene-3a,4,5,6,7,8,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-2-one |
|---|---|
| PubChem CID | 163188348 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (3aR,5aR,9aS,9bS)-5a-methyl-3,9-dimethylidene-3a,4,5,6,7,8,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-2-one |
| SMILES | C=C1CCC[C@]2(C)CC[C@H]3C(=C)C(=O)C[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C16H22O/c1-10-5-4-7-16(3)8-6-12-11(2)14(17)9-13(12)15(10)16/h12-13,15H,1-2,4-9H2,3H3/t12-,13-,15+,16+/m0/s1 |
| InChIKey | OINFTKHXNVCYLH-WMHQRMGPSA-N |
| XLogP | 3.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|