C12H16O5 — CID 163188920
[(2S,4R,7R,8Z)-4-hydroxy-2-methyl-10-oxo-2,3,4,7-tetrahydrooxecin-7-yl] acetate (PubChem CID 163188920) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is [(2S,4R,7R,8Z)-4-hydroxy-2-methyl-10-oxo-2,3,4,7-tetrahydrooxecin-7-yl] acetate.
| Compound Name | [(2S,4R,7R,8Z)-4-hydroxy-2-methyl-10-oxo-2,3,4,7-tetrahydrooxecin-7-yl] acetate |
|---|---|
| PubChem CID | 163188920 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | [(2S,4R,7R,8Z)-4-hydroxy-2-methyl-10-oxo-2,3,4,7-tetrahydrooxecin-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C[C@H](O)C[C@H](C)OC(=O)/C=C\1 |
| InChI | InChI=1S/C12H16O5/c1-8-7-10(14)3-4-11(17-9(2)13)5-6-12(15)16-8/h3-6,8,10-11,14H,7H2,1-2H3/b4-3?,6-5-/t8-,10-,11+/m0/s1 |
| InChIKey | IGZKYXHLVMUBGS-CWROTZEESA-N |
| XLogP | 0.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|