C25H44O4 — CID 163190153
(2S,3aS,6E,6aR)-6-decylidene-3a-methyl-2-nonyl-6aH-furo[2,3-d][1,3]dioxol-5-one (PubChem CID 163190153) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is (2S,3aS,6E,6aR)-6-decylidene-3a-methyl-2-nonyl-6aH-furo[2,3-d][1,3]dioxol-5-one.
| Compound Name | (2S,3aS,6E,6aR)-6-decylidene-3a-methyl-2-nonyl-6aH-furo[2,3-d][1,3]dioxol-5-one |
|---|---|
| PubChem CID | 163190153 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | (2S,3aS,6E,6aR)-6-decylidene-3a-methyl-2-nonyl-6aH-furo[2,3-d][1,3]dioxol-5-one |
| SMILES | CCCCCCCCC/C=C1/C(=O)O[C@]2(C)O[C@@H](CCCCCCCCC)O[C@H]12 |
| InChI | InChI=1S/C25H44O4/c1-4-6-8-10-12-14-15-17-19-21-23-25(3,29-24(21)26)28-22(27-23)20-18-16-13-11-9-7-5-2/h19,22-23H,4-18,20H2,1-3H3/b21-19+/t22-,23+,25-/m0/s1 |
| InChIKey | GFTJDZSXIJIXDB-VCWBDWOLSA-N |
| XLogP | 7.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|