C25H42O6 — CID 10863073
(3Z,5R)-3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-5-[10-(oxan-2-yloxy)decyl]oxolan-2-one (PubChem CID 10863073) has the molecular formula C25H42O6 and a molecular weight of 438.61 g/mol. Its IUPAC name is (3Z,5R)-3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-5-[10-(oxan-2-yloxy)decyl]oxolan-2-one.
| Compound Name | (3Z,5R)-3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-5-[10-(oxan-2-yloxy)decyl]oxolan-2-one |
|---|---|
| PubChem CID | 10863073 |
| Molecular Formula | C25H42O6 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (3Z,5R)-3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-5-[10-(oxan-2-yloxy)decyl]oxolan-2-one |
| SMILES | CC1(C)OC[C@@H](/C=C2/C[C@@H](CCCCCCCCCCOC3CCCCO3)OC2=O)O1 |
| InChI | InChI=1S/C25H42O6/c1-25(2)29-19-22(31-25)18-20-17-21(30-24(20)26)13-9-7-5-3-4-6-8-11-15-27-23-14-10-12-16-28-23/h18,21-23H,3-17,19H2,1-2H3/b20-18-/t21-,22-,23?/m1/s1 |
| InChIKey | NBJANQMNWVRDEE-GQWHMMFISA-N |
| XLogP | 5.43 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|