C23H33NO5 — CID 163190346
(2S)-2-[[(2E,4E,6R)-12-hydroxy-4,6-dimethyldodeca-2,4-dienoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 163190346) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is (2S)-2-[[(2E,4E,6R)-12-hydroxy-4,6-dimethyldodeca-2,4-dienoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[(2E,4E,6R)-12-hydroxy-4,6-dimethyldodeca-2,4-dienoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 163190346 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | (2S)-2-[[(2E,4E,6R)-12-hydroxy-4,6-dimethyldodeca-2,4-dienoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CC(/C=C/C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)=C\[C@H](C)CCCCCCO |
| InChI | InChI=1S/C23H33NO5/c1-17(7-5-3-4-6-14-25)15-18(2)8-13-22(27)24-21(23(28)29)16-19-9-11-20(26)12-10-19/h8-13,15,17,21,25-26H,3-7,14,16H2,1-2H3,(H,24,27)(H,28,29)/b13-8+,18-15+/t17-,21+/m1/s1 |
| InChIKey | ZQYJKIOOBBBACO-QEYZGOMESA-N |
| XLogP | 3.59 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|