C22H20N2O3 — CID 163193290
methyl (1R,11R,12S,13Z)-13-ethylidene-17-formyl-3,18-diazapentacyclo[10.6.1.02,10.04,9.014,18]nonadeca-2(10),4,6,8,14,16-hexaene-11-carboxylate (PubChem CID 163193290) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is methyl (1R,11R,12S,13Z)-13-ethylidene-17-formyl-3,18-diazapentacyclo[10.6.1.02,10.04,9.014,18]nonadeca-2(10),4,6,8,14,16-hexaene-11-carboxylate.
| Compound Name | methyl (1R,11R,12S,13Z)-13-ethylidene-17-formyl-3,18-diazapentacyclo[10.6.1.02,10.04,9.014,18]nonadeca-2(10),4,6,8,14,16-hexaene-11-carboxylate |
|---|---|
| PubChem CID | 163193290 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | methyl (1R,11R,12S,13Z)-13-ethylidene-17-formyl-3,18-diazapentacyclo[10.6.1.02,10.04,9.014,18]nonadeca-2(10),4,6,8,14,16-hexaene-11-carboxylate |
| SMILES | C/C=C1\c2ccc(C=O)n2[C@@H]2C[C@H]1[C@@H](C(=O)OC)c1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C22H20N2O3/c1-3-13-15-10-18(24-12(11-25)8-9-17(13)24)21-19(20(15)22(26)27-2)14-6-4-5-7-16(14)23-21/h3-9,11,15,18,20,23H,10H2,1-2H3/b13-3-/t15-,18-,20-/m1/s1 |
| InChIKey | LMQWGENTCNSYQP-WHFMRHSRSA-N |
| XLogP | 4.06 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|