C12H20O — CID 163195778
2-cyclohexa-1,3-dien-1-yl-4-methylpentan-1-ol (PubChem CID 163195778) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-4-methylpentan-1-ol.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 163195778 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-4-methylpentan-1-ol |
| SMILES | CC(C)CC(CO)C1=CC=CCC1 |
| InChI | InChI=1S/C12H20O/c1-10(2)8-12(9-13)11-6-4-3-5-7-11/h3-4,6,10,12-13H,5,7-9H2,1-2H3 |
| InChIKey | VDFBKBRJTZAUPW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |