C6H13ClN2 — CID 163198404
(1R,2R)-cyclohex-4-ene-1,2-diamine;hydrochloride (PubChem CID 163198404) has the molecular formula C6H13ClN2 and a molecular weight of 148.64 g/mol. Its IUPAC name is (1R,2R)-cyclohex-4-ene-1,2-diamine;hydrochloride.
| Compound Name | (1R,2R)-cyclohex-4-ene-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 163198404 |
| Molecular Formula | C6H13ClN2 |
| Molecular Weight | 148.64 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | (1R,2R)-cyclohex-4-ene-1,2-diamine;hydrochloride |
| SMILES | Cl.N[C@@H]1CC=CC[C@H]1N |
| InChI | InChI=1S/C6H12N2.ClH/c7-5-3-1-2-4-6(5)8;/h1-2,5-6H,3-4,7-8H2;1H/t5-,6-;/m1./s1 |
| InChIKey | QWKSYVBVTDXWFU-KGZKBUQUSA-N |
| XLogP | 0.41 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.64 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|