C7H11N3S — CID 163198763
N,N,1-trimethylpyrazole-4-carbothioamide (PubChem CID 163198763) has the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. Its IUPAC name is N,N,1-trimethylpyrazole-4-carbothioamide.
| Compound Name | N,N,1-trimethylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 163198763 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | N,N,1-trimethylpyrazole-4-carbothioamide |
| SMILES | CN(C)C(=S)c1cnn(C)c1 |
| InChI | InChI=1S/C7H11N3S/c1-9(2)7(11)6-4-8-10(3)5-6/h4-5H,1-3H3 |
| InChIKey | BLDGENMIOSGMIB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|