C30H45N5O8 — CID 163199667
methyl (3S)-3-methyl-2-[[(2S)-3-methyl-2-[[(2S)-1-[2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]butanoyl]amino]pentanoate (PubChem CID 163199667) has the molecular formula C30H45N5O8 and a molecular weight of 603.72 g/mol. Its IUPAC name is methyl (3S)-3-methyl-2-[[(2S)-3-methyl-2-[[(2S)-1-[2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]butanoyl]amino]pentanoate.
| Compound Name | methyl (3S)-3-methyl-2-[[(2S)-3-methyl-2-[[(2S)-1-[2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]butanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 163199667 |
| Molecular Formula | C30H45N5O8 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.33 |
| IUPAC Name | methyl (3S)-3-methyl-2-[[(2S)-3-methyl-2-[[(2S)-1-[2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]butanoyl]amino]pentanoate |
| SMILES | CC[C@H](C)C(NC(=O)[C@@H](NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](C)NC(=O)OCc1ccccc1)C(C)C)C(=O)OC |
| InChI | InChI=1S/C30H45N5O8/c1-7-19(4)25(29(40)42-6)34-28(39)24(18(2)3)33-27(38)22-14-11-15-35(22)23(36)16-31-26(37)20(5)32-30(41)43-17-21-12-9-8-10-13-21/h8-10,12-13,18-20,22,24-25H,7,11,14-17H2,1-6H3,(H,31,37)(H,32,41)(H,33,38)(H,34,39)/t19-,20-,22-,24-,25?/m0/s1 |
| InChIKey | SOGBYCSYCOUBDY-BIUHCYQDSA-N |
| XLogP | 1.25 |
| TPSA | 172.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |