C8H15NO6 — CID 163201287
(2R,3S,4R,5S)-2-(hydroxymethyl)-5-[[(2R)-2-hydroxyoxiran-2-yl]amino]oxane-3,4-diol (PubChem CID 163201287) has the molecular formula C8H15NO6 and a molecular weight of 221.21 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-(hydroxymethyl)-5-[[(2R)-2-hydroxyoxiran-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-[[(2R)-2-hydroxyoxiran-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 163201287 |
| Molecular Formula | C8H15NO6 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-[[(2R)-2-hydroxyoxiran-2-yl]amino]oxane-3,4-diol |
| SMILES | OC[C@H]1OC[C@H](N[C@@]2(O)CO2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H15NO6/c10-1-5-7(12)6(11)4(2-14-5)9-8(13)3-15-8/h4-7,9-13H,1-3H2/t4-,5+,6+,7+,8+/m0/s1 |
| InChIKey | YLTTTWSEJMVRQV-SLBCVNJHSA-N |
| XLogP | -3.27 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|