C25H23F3N4OS — CID 163201620
N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperidin-1-yl]phenyl]methyl]thieno[3,2-d]pyrimidin-4-amine (PubChem CID 163201620) has the molecular formula C25H23F3N4OS and a molecular weight of 484.55 g/mol. Its IUPAC name is N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperidin-1-yl]phenyl]methyl]thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperidin-1-yl]phenyl]methyl]thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 163201620 |
| Molecular Formula | C25H23F3N4OS |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperidin-1-yl]phenyl]methyl]thieno[3,2-d]pyrimidin-4-amine |
| SMILES | FC(F)(F)Oc1ccc(C2CCN(c3ccc(CNc4ncnc5ccsc45)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H23F3N4OS/c26-25(27,28)33-21-7-3-18(4-8-21)19-9-12-32(13-10-19)20-5-1-17(2-6-20)15-29-24-23-22(11-14-34-23)30-16-31-24/h1-8,11,14,16,19H,9-10,12-13,15H2,(H,29,30,31) |
| InChIKey | HXAQLZRLMOAVNX-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|