C9H15N3O6S — CID 163202992
2-[(2S,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl]ethyl hydrogen sulfate (PubChem CID 163202992) has the molecular formula C9H15N3O6S and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-[(2S,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl]ethyl hydrogen sulfate.
| Compound Name | 2-[(2S,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 163202992 |
| Molecular Formula | C9H15N3O6S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-[(2S,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl]ethyl hydrogen sulfate |
| SMILES | NC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2CCOS(=O)(=O)O |
| InChI | InChI=1S/C9H15N3O6S/c10-8(13)7-2-1-6-5-12(7)9(14)11(6)3-4-18-19(15,16)17/h6-7H,1-5H2,(H2,10,13)(H,15,16,17)/t6-,7+/m1/s1 |
| InChIKey | HKJBMPMCYOFNNM-RQJHMYQMSA-N |
| XLogP | -1.44 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|