C15H14N6O4S — CID 163203806
3-methoxy-4-[[5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,3,4-thiadiazol-2-yl]iminomethyl]phenol (PubChem CID 163203806) has the molecular formula C15H14N6O4S and a molecular weight of 374.38 g/mol. Its IUPAC name is 3-methoxy-4-[[5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,3,4-thiadiazol-2-yl]iminomethyl]phenol.
| Compound Name | 3-methoxy-4-[[5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,3,4-thiadiazol-2-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 163203806 |
| Molecular Formula | C15H14N6O4S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 3-methoxy-4-[[5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,3,4-thiadiazol-2-yl]iminomethyl]phenol |
| SMILES | COc1cc(O)ccc1C=Nc1nnc(Cn2c([N+](=O)[O-])cnc2C)s1 |
| InChI | InChI=1S/C15H14N6O4S/c1-9-16-7-14(21(23)24)20(9)8-13-18-19-15(26-13)17-6-10-3-4-11(22)5-12(10)25-2/h3-7,22H,8H2,1-2H3 |
| InChIKey | FTONGOHRGQATEW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|