C14H11N7O4S — CID 163203810
N-[5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,3,4-thiadiazol-2-yl]-1-(4-nitrophenyl)methanimine (PubChem CID 163203810) has the molecular formula C14H11N7O4S and a molecular weight of 373.35 g/mol. Its IUPAC name is N-[5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,3,4-thiadiazol-2-yl]-1-(4-nitrophenyl)methanimine.
| Compound Name | N-[5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,3,4-thiadiazol-2-yl]-1-(4-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 163203810 |
| Molecular Formula | C14H11N7O4S |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | N-[5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,3,4-thiadiazol-2-yl]-1-(4-nitrophenyl)methanimine |
| SMILES | Cc1ncc([N+](=O)[O-])n1Cc1nnc(N=Cc2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C14H11N7O4S/c1-9-15-7-13(21(24)25)19(9)8-12-17-18-14(26-12)16-6-10-2-4-11(5-3-10)20(22)23/h2-7H,8H2,1H3 |
| InChIKey | RGLTVZRDOUTONY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 142.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|