C14H13N7O4 — CID 155926428
4-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1-[(4-nitrophenyl)methyl]triazole (PubChem CID 155926428) has the molecular formula C14H13N7O4 and a molecular weight of 343.30 g/mol. Its IUPAC name is 4-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1-[(4-nitrophenyl)methyl]triazole.
| Compound Name | 4-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1-[(4-nitrophenyl)methyl]triazole |
|---|---|
| PubChem CID | 155926428 |
| Molecular Formula | C14H13N7O4 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 4-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1-[(4-nitrophenyl)methyl]triazole |
| SMILES | Cc1ncc([N+](=O)[O-])n1Cc1cn(Cc2ccc([N+](=O)[O-])cc2)nn1 |
| InChI | InChI=1S/C14H13N7O4/c1-10-15-6-14(21(24)25)19(10)9-12-8-18(17-16-12)7-11-2-4-13(5-3-11)20(22)23/h2-6,8H,7,9H2,1H3 |
| InChIKey | KNUHSWKVMAQLHF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 134.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|