C15H14Cl2N6O3 — CID 127053412
4-[(2,4-dichlorophenoxy)methyl]-1-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]triazole (PubChem CID 127053412) has the molecular formula C15H14Cl2N6O3 and a molecular weight of 397.22 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenoxy)methyl]-1-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]triazole.
| Compound Name | 4-[(2,4-dichlorophenoxy)methyl]-1-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]triazole |
|---|---|
| PubChem CID | 127053412 |
| Molecular Formula | C15H14Cl2N6O3 |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 4-[(2,4-dichlorophenoxy)methyl]-1-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]triazole |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCn1cc(COc2ccc(Cl)cc2Cl)nn1 |
| InChI | InChI=1S/C15H14Cl2N6O3/c1-10-18-7-15(23(24)25)22(10)5-4-21-8-12(19-20-21)9-26-14-3-2-11(16)6-13(14)17/h2-3,6-8H,4-5,9H2,1H3 |
| InChIKey | LQADXHIIAUFEJK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|